| Cas Number: | 355129-15-6 |
| Chembl: | 2035874 |
| Chemspiderid: | 8475344 |
| Pubchem: | 10299876 |
| Unii: | 958AQ7B6R1 |
| Drugbank: | DB05035 |
| Stdinchi: | 1S/C18H17Br2NO5/c1-9(2)12-7-11(3-4-15(12)22)26-18-13(19)5-10(6-14(18)20)21-16(23)8-17(24)25/h3-7,9,22H,8H2,1-2H3,(H,21,23)(H,24,25) |
| Stdinchikey: | VPCSYAVXDAUHLT-UHFFFAOYSA-N |
| Smiles: | CC(C)C1=C(C=CC(=C1)OC2=C(C=C(C=C2Br)NC(=O)CC(=O)O)Br)O |
| Iupac Name: | 2-(carbamoyl)acetic acid |
| C: | 18 |
| H: | 17 |
| Br: | 2 |
| N: | 2 |
| O: | 5 |
Eprotirome is a thyromimetic drug that has been investigated for the treatment of dyslipidemia. A Phase III trial in humans was discontinued after the drug was found to have negative effects on cartilage in dogs.[1] [2]