| Cas Number: | 1198153-15-9 |
| Pubchem: | 44608229 |
| Chemspiderid: | 35143241 |
| Unii: | 0YP1ME85GH |
| Chembl: | 4640580 |
| Synonyms: | URC102/UR-1102 |
| Iupac Name: | (3,5-dibromo-4-hydroxyphenyl)-(2,3-dihydropyrido[4,3-b][1,4]oxazin-4-yl)methanone| C=14 | H=10 | Br=2 | N=2 | O=3| molecular_weight = | SMILES = C1COC2=C(N1C(=O)C3=CC(=C(C(=C3)Br)O)Br)C=NC=C2| Jmol = | StdInChI = InChI=1S/C14H10Br2N2O3/c15-9-5-8(6-10(16)13(9)19)14(20)18-3-4-21-12-1-2-17-7-11(12)18/h1-2,5-7,19H,3-4H2| StdInChI_comment = | StdInChIKey = ZMVGQIIOXCGAFV-UHFFFAOYSA-N| density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}Epaminurad is an investigational new drug being developed by JW Pharmaceutical for the treatment of gout and hyperuricemia. It is a urate-lowering agent that selectively inhibits the human uric acid transporter 1 (hURAT1), promoting urate excretion.[1] [2] As of 2024, epaminurad is undergoing Phase 3 clinical trials to evaluate its efficacy and safety compared to febuxostat in gout patients across multiple Asian countries.[3] References] |