| Iupac Name: | 6-(1H-Indazol-6-yl)-N-(4-morpholin-4-ylphenyl)imidazo[1,2-a]pyrazin-8-amine |
| Legal Status: | Investigational |
| Cas Number: | 1229208-44-9 |
| Pubchem: | 59473233 |
| Drugbank: | 12121 |
| Unii: | 6I3O3W6O3B |
| Kegg: | D11209 |
| Synonyms: | GS-9973 |
| C: | 23 |
| H: | 21 |
| N: | 7 |
| O: | 1 |
| Smiles: | c1cn2cc(-c3ccc4cn[nH]c4c3)nc(Nc3ccc(N4CCOCC4)cc3)c2n1 |
| Stdinchi: | 1S/C23H21N7O/c1-2-17-14-25-28-20(17)13-16(1)21-15-30-8-7-24-23(30)22(27-21)26-18-3-5-19(6-4-18)29-9-11-31-12-10-29/h1-8,13-15H,9-12H2,(H,25,28)(H,26,27) |
| Stdinchikey: | XSMSNFMDVXXHGJ-UHFFFAOYSA-N |
Entospletinib is an experimental drug for the treatment of various types of cancer under development by Gilead Sciences. It is an inhibitor of spleen tyrosine kinase (Syk).[1] It has entered clinical trials for acute myeloid leukaemia (AML), chronic lymphocytic leukemia (CLL),[2] diffuse large B cell lymphoma (DLBCL), graft-versus-host disease (GvHD), hematological malignancies, mantle cell lymphoma (MCL), and non-Hodgkin lymphoma (NHL).[3]