| Routes Of Administration: | Intravenous |
| Class: | Antibacterial, beta-lactamase inhibitor |
| Atc Prefix: | None |
| Legal Us: | Rx-only |
| Legal Us Comment: | co-packaged with sulbactam |
| Cas Number: | 1467829-71-5 |
| Pubchem: | 89851852 |
| Drugbank: | DB16704 |
| Drugbank2: | DBSALT003190 |
| Chemspiderid: | 57617784 |
| Chemspiderid2: | 71060725 |
| Unii: | PSA33KO9WA |
| Unii2: | F78MDZ9CW9 |
| Kegg: | D11591 |
| Kegg2: | D11592 |
| Chembl: | 4298137 |
| Chembl2: | 4297378 |
| Iupac Name: | [(2''S'',5''R'')-2-carbamoyl-3-methyl-7-oxo-1,6-diazabicyclo[3.2.1]oct-3-en-6-yl] hydrogen sulfate |
| C: | 8 |
| H: | 11 |
| N: | 3 |
| O: | 6 |
| S: | 1 |
| Smiles: | CC1=C[C@@H]2C[N@]([C@@H]1C(N)=O)C(=O)N2OS(O)(=O)=O |
| Stdinchi: | 1S/C8H11N3O6S/c1-4-2-5-3-10(6(4)7(9)12)8(13)11(5)17-18(14,15)16/h2,5-6H,3H2,1H3,(H2,9,12)(H,14,15,16)/t5-,6+/m1/s1 |
| Stdinchikey: | BISPBXFUKNXOQY-RITPCOANSA-N |
Durlobactam is a beta-lactamase inhibitor used in combination with sulbactam to treat susceptible strains of bacteria in the genus Acinetobacter It is an analog of avibactam.
The combination therapy sulbactam/durlobactam was approved for medical use in the United States in May 2023.[1]