| Width: | 250px |
| Width2: | 250px |
| Tradename: | Auxiloson, Auxilson, Auxilsone, Voren |
| Cas Number: | 2265-64-7 |
| Pubchem: | 16752 |
| Drugbank: | DB11487 |
| Chemspiderid: | 15881 |
| Unii: | 8LGC0BOA71 |
| Kegg: | D07797 |
| Chebi: | 177639 |
| Chembl: | 3186453 |
| Synonyms: | Dexamethasone 21-isonicotinate; Dexamethasone 21-(4-Pyridinecarboxylate); HE-111; 9α-Fluoro-11β,17α-dihydroxy-16α-methyl-3,20-dioxopregna-1,4-dien-21-yl isonicotinate; 9α-Fluoro-11β,17α,21-trihydroxy-16α-methylpregna-1,4-diene-3,20-dione 21-(4-pyridinecarboxylate) |
| Iupac Name: | 2-[(1''R'',2''R'',3a''S'',3b''S'',9a''S'',9b''R'',10''S'',11a''S'')-9b-fluoro-1,10-dihydroxy-2,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,7,9a,9b,10,11,11a-dodecahydro-1''H''-cyclopenta[''a'']phenanthren-1-yl]-2-oxoethyl pyridine-4-carboxylate |
| C: | 28 |
| H: | 32 |
| F: | 1 |
| N: | 1 |
| O: | 6 |
| Smiles: | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)COC(=O)C5=CC=NC=C5)O)C)O)F)C |
| Stdinchi: | 1S/C28H32FNO6/c1-16-12-21-20-5-4-18-13-19(31)6-9-25(18,2)27(20,29)22(32)14-26(21,3)28(16,35)23(33)15-36-24(34)17-7-10-30-11-8-17/h6-11,13,16,20-22,32,35H,4-5,12,14-15H2,1-3H3/t16-,20+,21+,22+,25+,26+,27+,28+/m1/s1 |
| Stdinchikey: | BQTXJHAJMDGOFI-NJLPOHDGSA-N |
Dexamethasone isonicotinate is an anti-inflammatory, anti-allergic glucocorticoid that can be administered orally, by inhalation, locally, and parenterally.[1] [2] It may cause salt and water retention.