Drug Name: | Desmethoxyfallypride (18F) |
Width: | 240 |
Atc Prefix: | none |
Cas Number: | 166173-81-5 |
Pubchem: | 10404663 |
Chemspiderid: | 8580101 |
Unii: | CJD4EF9EME |
Chembl: | 428561 |
Synonyms: | DMFP (18F) |
Iupac Name: | 5-(3-fluoropropyl)-2-methoxy-N-(2S)-1-prop-2-enylpyrrolidin-2-ylmethyl]benzamide| C=19 | H=27 | F=1 | N=2 | O=2| SMILES = COC1=C(C=C(C=C1)CCCF)C(=O)NC[C@@H]2CCCN2CC=C| StdInChI = 1S/C19H27FN2O2/c1-3-11-22-12-5-7-16(22)14-21-19(23)17-13-15(6-4-10-20)8-9-18(17)24-2/h3,8-9,13,16H,1,4-7,10-12,14H2,2H3,(H,21,23)/t16-/m0/s1| StdInChIKey = VPBJNBUDASILSQ-INIZCTEOSA-N}} Desmethoxyfallypride is a moderate affinity dopamine D2 receptor/D3 receptor antagonist used in medical research, usually in the form of the radiopharmaceutical [F-18]-desmethoxyfallypride (DMFP(18F))[1] [2] which has been used in human studies as a positron emission tomography (PET) radiotracer.[3] [4] References |