| Drug Name: | Datumetine |
| Cas Number: | 67078-20-0 |
| Pubchem: | 181868 |
| Chemspiderid: | 158188 |
| Iupac Name: | 4-Methoxy-3-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)benzoic acid |
| C: | 16 |
| H: | 21 |
| N: | 1 |
| O: | 3 |
| Smiles: | O=C(O)C1=CC=C(OC)C(=C1)C2CC3N(C)C(CC3)C2 |
| Stdinchi: | 1S/C16H21NO3/c1-17-12-4-5-13(17)8-11(7-12)14-9-10(16(18)19)3-6-15(14)20-2/h3,6,9,11-13H,4-5,7-8H2,1-2H3,(H,18,19) |
| Stdinchikey: | CMMJWJKGQZIJPB-UHFFFAOYSA-N |
Datumetine is a tropane alkaloid found in leaves of Datura metel.[1] It is said to modulate NMDA receptor and thus causes memory loss.[2] It also causes epileptic seizures in mice. Docking studies suggest that it fits on both allosteric and orthosteric sites of NMDA receptor. It acts together with other anticholinergic tropane alkaloids of datura to cause amnesia.