| Type: | combo |
| Component1: | Darunavir |
| Class1: | HIV protease inhibitor |
| Component2: | Cobicistat |
| Class2: | Cytochrome P450 (CYP3A) inhibitor |
| Tradename: | Rezolsta, Prezcobix |
| Dailymedid: | Prezcobix |
| Pregnancy Au: | B2 |
| Pregnancy Au Comment: | [1] |
| Legal Au: | S4 |
| Legal Ca: | Rx-only |
| Legal Ca Comment: | [2] |
| Legal Us: | Rx-only |
| Legal Eu: | Rx-only |
| Routes Of Administration: | By mouth |
| Atc Prefix: | J05 |
| Atc Suffix: | AR14 |
| Cas Number: | 206361-99-1 |
| Cas Number2: | 1004316-88-4 |
| Pubchem: | 57327017 |
| Kegg: | D10832 |
| Unii: | YO603Y8113 |
| Unii2: | LW2E03M5PG |
| C: | 67 |
| H: | 90 |
| N: | 10 |
| O: | 12 |
| S: | 3 |
| Smiles: | CC(C)CN(CC(C(CC1=CC=CC=C1)NC(=O)OC2COC3C2CCO3)O)S(=O)(=O)C4=CC=C(C=C4)N.CC(C)C1=NC(=CS1)CN(C)C(=O)NC(CCN2CCOCC2)C(=O)NC(CCC(CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)CC5=CC=CC=C5 |
| Stdinchi: | 1S/C40H53N7O5S2.C27H37N3O7S/c1-29(2)38-43-34(27-53-38)25-46(3)39(49)45-36(16-17-47-18-20-51-21-19-47)37(48)42-32(22-30-10-6-4-7-11-30)14-15-33(23-31-12-8-5-9-13-31)44-40(50)52-26-35-24-41-28-54-35;1-18(2)15-30(38(33,34)21-10-8-20(28)9-11-21)16-24(31)23(14-19-6-4-3-5-7-19)29-27(32)37-25-17-36-26-22(25)12-13-35-26/h4-13,24,27-29,32-33,36H,14-23,25-26H2,1-3H3,(H,42,48)(H,44,50)(H,45,49);3-11,18,22-26,31H,12-17,28H2,1-2H3,(H,29,32)/t32-,33-,36+;22-,23-,24+,25-,26+/m10/s1 |
| Stdinchikey: | CXORHDVSJFELCV-HWDLLDTBSA-N |
Darunavir/cobicistat, sold under the brand names Prezcobix (US) and Rezolsta (EU), is a fixed-dose combination antiretroviral medication used to treat and prevent HIV/AIDS. It contains darunavir and cobicistat.[3] [4] Darunavir is an HIV protease inhibitor and cobicistat increases the effectiveness of darunavir by blocking its metabolism by the enzyme CYP3A.
Darunavir/cobicistat was approved for use in the European Union in November 2014, and for use in the United States in January 2015.[5] [6] [7] [8] [9]