| Drug Name: | Dalpiciclib |
| Synonyms: | SHR-6390 |
| Cas Number: | 1637781-04-4 |
| Pubchem: | 86279927 |
| Unii: | 5ZHA5P4PFX |
| Drugbank: | DB17456 |
| Chembl: | 4802161 |
| Iuphar Ligand: | 11189 |
| Chemspiderid: | 114951729 |
| Iupac Name: | 6-Acetyl-8-cyclopentyl-5-methyl-2-[(5-piperidin-4-ylpyridin-2-yl)amino]pyrido[2,3-''d'']pyrimidin-7-one |
| C: | 25 |
| H: | 30 |
| N: | 6 |
| O: | 2 |
| Stdinchi: | 1S/C25H30N6O2/c1-15-20-14-28-25(29-21-8-7-18(13-27-21)17-9-11-26-12-10-17)30-23(20)31(19-5-3-4-6-19)24(33)22(15)16(2)32/h7-8,13-14,17,19,26H,3-6,9-12H2,1-2H3,(H,27,28,29,30) |
| Stdinchikey: | SGJLSPUSUBJWHO-UHFFFAOYSA-N |
| Smiles: | CC1=C(C(=O)N(C2=NC(=NC=C12)NC3=NC=C(C=C3)C4CCNCC4)C5CCCC5)C(=O)C |
Dalpiciclib is a drug for the treatment of various forms of cancer.[1]
In China, dalpiciclib is approved for use in combination with fulvestrant for treatment of HR-positive, HER2-negative recurrent, or metastatic breast cancer in patients who have progressed after previous endocrine therapy.[2]
Dalpicicilib is a CDK inhibitor that targets the CDK4 and CDK6 isoforms.[3]