| Tradename: | Pivlaz |
| Atc Prefix: | C04 |
| Atc Suffix: | AX33 |
| Legal Status: | Rx-only |
| Cas Number: | 180384-56-9 |
| Pubchem: | 6433095 |
| Drugbank: | DB06677 |
| Chemspiderid: | 4938283 |
| Unii: | 3DRR0X4728 |
| Kegg: | D11664 |
| Chembl: | 109648 |
| Iupac Name: | 5-methyl-pyridin-2-sulfonic acidamide |
| C: | 25 |
| H: | 23 |
| N: | 9 |
| O: | 6 |
| S: | 1 |
| Smiles: | CC1=CN=C(C=C1)S(=O)(=O)NC2=C(C(=NC(=N2)C3=CC(=NC=C3)C4=NNN=N4)OCCO)OC5=CC=CC=C5OC |
| Stdinchi: | 1S/C25H23N9O6S/c1-15-7-8-20(27-14-15)41(36,37)32-24-21(40-19-6-4-3-5-18(19)38-2)25(39-12-11-35)29-22(28-24)16-9-10-26-17(13-16)23-30-33-34-31-23/h3-10,13-14,35H,11-12H2,1-2H3,(H,28,29,32)(H,30,31,33,34) |
| Stdinchikey: | LFWCJABOXHSRGC-UHFFFAOYSA-N |
Clazosentan (INN, brand name Pivlaz[1]) is a drug belonging to the class of endothelin receptor antagonists.
The endothelin 1 receptor is one of the strongest known vasoconstrictors. After subarachnoidal bleedings, irritation of the blood vessels can lead to a vasospasm and thus to an ischaemia, an insufficient blood supply to brain tissue. One possible effect of this is, in turn, an ischaemic stroke.
In a randomized trial with patients who had aneurysmal subarachnoid bleeding and were being treated with endovascular coiling, 15 mg/h clazosentan significantly reduced vasospasm-related morbidity and all-cause mortality. Clazosentan, however, did not improve the neurological outcome as measured by the extended Glascow Outcome Scale.[2]