| Class: | Antidepressant
|
| Cas Number: | 54141-87-6 |
| Pubchem: | 6443800 |
| Chemspiderid: | 4947762 |
| Unii: | P26FL0O04P |
| Chembl: | 2104102 |
| Iupac Name: | (E)-N-(2-benzhydryloxyethyl)-N-methyl-3-phenylprop-2-en-1-amine |
| C: | 25 |
| H: | 27 |
| N: | 1 |
| O: | 1 |
| Smiles: | CN(CCOC(C1=CC=CC=C1)C2=CC=CC=C2)C/C=C/C3=CC=CC=C3 |
| Stdinchi: | 1S/C25H27NO/c1-26(19-11-14-22-12-5-2-6-13-22)20-21-27-25(23-15-7-3-8-16-23)24-17-9-4-10-18-24/h2-18,25H,19-21H2,1H3/b14-11+ |
| Stdinchikey: | QTKQVDXGCWKEHE-SDNWHVSQSA-N |
Cinfenine is a drug described as an antidepressant and coronary vasodilator which was never marketed.[1] [2] [3] It was first described in the literature by 1970.[4] The drug is similar in chemical structure to the modafinil derivative and atypical dopamine reuptake inhibitor JJC8-016, as well as to the antihistamine and anticholinergic diphenhydramine and derivatives of diphenhydramine like ebastine.[5]