| Pubchem: | 959689 |
| Chemspiderid: | 832832 |
| Synonyms: | ADK-910; Chlodantan; N-(2-Adamantyl)-N-(para-chlorobenzoyl)amine; 2-(para-Chlorobenzoylamino)adamantane |
| Iupac Name: | N-(2-adamantyl)-4-chlorobenzamide |
| C: | 17 |
| H: | 20 |
| Cl: | 1 |
| N: | 1 |
| O: | 1 |
| Smiles: | C1C2CC3CC1CC(C2)C3NC(=O)C4=CC=C(C=C4)Cl |
| Stdinchi: | 1S/C17H20ClNO/c18-15-3-1-12(2-4-15)17(20)19-16-13-6-10-5-11(8-13)9-14(16)7-10/h1-4,10-11,13-14,16H,5-9H2,(H,19,20) |
| Stdinchikey: | VOHIYJJUKAUCCU-UHFFFAOYSA-N |
Chlodantane (developmental code name ADK-910) is a drug described as an adaptogen or actoprotector "of the estrogen activity type" that was developed in Russia and was never marketed.[1] [2] It is an adamantane derivative and is closely related to bromantane (N-(2-adamantyl)-N-(para-bromophenyl)amine) and other adamantanes. It has been said to improve physical performance. However, only animal or cell culture research has been conducted and it has not been studied in humans. The drug is described as having a broader spectrum of activity than bromantane. It also has immunostimulant effects that are said to be more pronounced than those of bromantane.