| Legal Status: | Investigational |
| Cas Number: | 1352226-88-0 |
| Pubchem: | 54761306 |
| Iuphar Ligand: | 9390 |
| Drugbank: | DB14917 |
| Chemspiderid: | 58828171 |
| Unii: | 85RE35306Z |
| Kegg: | D11787 |
| Chembl: | 4285417 |
| Pdb Ligand: | VJM |
| Synonyms: | AZD-6738 |
| Iupac Name: | imino-methyl-[1-[6-[(3R)-3-methylmorpholin-4-yl]-2-(1H-pyrrolo[2,3-b]pyridin-4-yl)pyrimidin-4-yl]cyclopropyl]-oxo-lambda6-sulfane |
| C: | 20 |
| H: | 24 |
| N: | 6 |
| O: | 2 |
| S: | 1 |
| Smiles: | C[C@@H]1COCCN1C2=NC(=NC(=C2)C3(CC3)[S@](=N)(=O)C)C4=C5C=CNC5=NC=C4 |
| Stdinchi: | 1S/C20H24N6O2S/c1-13-12-28-10-9-26(13)17-11-16(20(5-6-20)29(2,21)27)24-19(25-17)15-4-8-23-18-14(15)3-7-22-18/h3-4,7-8,11,13,21H,5-6,9-10,12H2,1-2H3,(H,22,23)/t13-,29-/m1/s1 |
| Stdinchikey: | OHUHVTCQTUDPIJ-JYCIKRDWSA-N |
Ceralasertib is an investigational new drug that is being evaluated for the treatment of cancer.[1] It is an ATR kinase inhibitor.[2]