| Legal Status: | Investigational |
| Cas Number: | 1262414-04-9 |
| Pubchem: | 49871973 |
| Iuphar Ligand: | 9824 |
| Drugbank: | DB12705 |
| Chemspiderid: | 52084350 |
| Unii: | Y333RS1786 |
| Kegg: | D11283 |
| Chembl: | 4297505 |
| Synonyms: | ACT-334441 |
| Iupac Name: | (2S)-3-[4-[5-(2-cyclopentyl-6-methoxypyridin-4-yl)-1,2,4-oxadiazol-3-yl]-2-ethyl-6-methylphenoxy]propane-1,2-diol |
| C: | 25 |
| H: | 31 |
| N: | 3 |
| O: | 5 |
| Smiles: | CCC1=C(C(=CC(=C1)C2=NOC(=N2)C3=CC(=NC(=C3)OC)C4CCCC4)C)OC[C@H](CO)O |
| Stdinchi: | 1S/C25H31N3O5/c1-4-16-10-18(9-15(2)23(16)32-14-20(30)13-29)24-27-25(33-28-24)19-11-21(17-7-5-6-8-17)26-22(12-19)31-3/h9-12,17,20,29-30H,4-8,13-14H2,1-3H3/t20-/m0/s1 |
| Stdinchikey: | KJKKMMMRWISKRF-FQEVSTJZSA-N |
Cenerimod is an investigational new drug that is being evaluated for the treatment of systemic lupus erythematosus.[1] It is a sphingosine-1-phosphate receptor modulator.[2]