Legal Status: | Investigational |
Cas Number: | 2222844-89-3 |
Pubchem: | 134453496 |
Iuphar Ligand: | 12716 |
Drugbank: | DB19218 |
Chemspiderid: | 103820855 |
Unii: | JUP57A8EPZ |
Kegg: | D12049 |
Chembl: | 4650365 |
Synonyms: | AZD9833 |
Iupac Name: | N-[1-(3-fluoropropyl)azetidin-3-yl]-6-[(6S,8R)-8-methyl-7-(2,2,2-trifluoroethyl)-3,6,8,9-tetrahydropyrazolo[4,3-f]isoquinolin-6-yl]pyridin-3-amine |
C: | 24 |
H: | 28 |
F: | 4 |
N: | 6 |
Smiles: | C[C@@H]1CC2=C(C=CC3=C2C=NN3)[C@H](N1CC(F)(F)F)C4=NC=C(C=C4)NC5CN(C5)CCCF |
Stdinchi: | 1S/C24H28F4N6/c1-15-9-19-18(4-6-21-20(19)11-30-32-21)23(34(15)14-24(26,27)28)22-5-3-16(10-29-22)31-17-12-33(13-17)8-2-7-25/h3-6,10-11,15,17,23,31H,2,7-9,12-14H2,1H3,(H,30,32)/t15-,23+/m1/s1 |
Stdinchikey: | WDHOIABIERMLGY-CMJOXMDJSA-N |
Camizestrant is an investigational new drug that is being evaluated to treat breast cancer.[1] It is an estrogen receptor alpha antagonist and a selective estrogen receptor degrader (SERD).[2]