| Tradename: | Bromidol Depot, Bromodol Decanoato, Impromen Decanoas |
| Routes Of Administration: | Intramuscular injection |
| Class: | Typical antipsychotic |
| Legal Status: | Rx-only |
| Cas Number: | 75067-66-2 |
| Pubchem: | 156321 |
| Chemspiderid: | 137658 |
| Unii: | 73LG72M4LV |
| Kegg: | D02626 |
| Chembl: | 2106135 |
| Synonyms: | R-46541; R-46,541 |
| Iupac Name: | [4-(4-bromophenyl)-1-[4-(4-fluorophenyl)-4-oxobutyl]piperidin-4-yl] decanoate |
| C: | 31 |
| H: | 41 |
| Br: | 1 |
| F: | 1 |
| N: | 1 |
| O: | 3 |
| Smiles: | CCCCCCCCCC(=O)OC1(CCN(CC1)CCCC(=O)C2=CC=C(C=C2)F)C3=CC=C(C=C3)Br |
| Stdinchi: | 1S/C31H41BrFNO3/c1-2-3-4-5-6-7-8-11-30(36)37-31(26-14-16-27(32)17-15-26)20-23-34(24-21-31)22-9-10-29(35)25-12-18-28(33)19-13-25/h12-19H,2-11,20-24H2,1H3 |
| Stdinchikey: | ZINCPWWBSRSXBH-UHFFFAOYSA-N |
Bromperidol decanoate, sold under the brand names Bromidol Depot, Bromodol Decanoato, and Impromen Decanoas, is an antipsychotic which has been marketed in Europe and Latin America.[1] [2] It is an antipsychotic ester and long-acting prodrug of bromperidol which is administered by depot intramuscular injection once every 4 weeks.[3] [4]