| Routes Of Administration: | Oral |
| Class: | Serotonin 5-HT2C receptor agonist |
| Elimination Half-Life: | 5–7 hours |
| Cas Number: | 2035818-24-5 |
| Pubchem: | 122662787 |
| Drugbank: | DB18885 |
| Chemspiderid: | 129309383 |
| Unii: | R8XR1D6SCB |
| Chembl: | 5314507 |
| Synonyms: | LP352; LP-352; AN352; AN-352 |
| Iupac Name: | (3R)-N-(2,2-difluoroethyl)-3-methyl-1,10-diazatricyclo[6.4.1.0<sup>4,13</sup>]trideca-4,6,8(13)-triene-5-carboxamide |
| C: | 15 |
| H: | 19 |
| F: | 2 |
| N: | 3 |
| O: | 1 |
| Smiles: | C[C@H]1CN2CCNCC3=C2C1=C(C=C3)C(=O)NCC(F)F |
| Stdinchi: | 1S/C15H19F2N3O/c1-9-8-20-5-4-18-6-10-2-3-11(13(9)14(10)20)15(21)19-7-12(16)17/h2-3,9,12,18H,4-8H2,1H3,(H,19,21)/t9-/m0/s1 |
| Stdinchikey: | KGOOOHQKLRUVSF-VIFPVBQESA-N |
Bexicaserin (; developmental code names LP352 and AN352) is a selective serotonin 5-HT2C receptor agonist which is under development for the treatment of seizures in developmental disabilities such as Dravet syndrome and Lennox-Gastaut syndrome.[1] [2] [3] It is taken by mouth.
The drug is highly selective for the serotonin 5-HT2C receptor, with negligible affinity for the serotonin 5-HT2A and 5-HT2B receptors. Because it does not activate the serotonin 5-HT2B receptor, bexicaserin is not expected to pose a risk of cardiac valvulopathy, unlike the existing agent fenfluramine.
As of October 2024, bexicaserin is in phase 3 clinical trials for treatment of developmental disabilities. It is being developed by Longboard Pharmaceuticals.