| Cas Number: | 39544-74-6 |
| Pubchem: | 2060890 |
| Chemspiderid: | 1553298 |
| Unii: | LS5O682BRO |
| Chembl: | 63544 |
| Synonyms: | Benzotrypt; CR-501; N-(p-Chlorobenzoyl)-L-tryptophan; N-(4-Chlorobenzoyl)-L-tryptophan; N-[(4-Chlorophenyl)carbonyl]tryptophan |
| Iupac Name: | (2S)-2-[(4-chlorobenzoyl)amino]-3-(1H-indol-3-yl)propanoic acid |
| C: | 18 |
| H: | 15 |
| Cl: | 1 |
| N: | 2 |
| O: | 3 |
| Smiles: | C1=CC=C2C(=C1)C(=CN2)C[C@@H](C(=O)O)NC(=O)C3=CC=C(C=C3)Cl |
| Stdinchi: | 1S/C18H15ClN2O3/c19-13-7-5-11(6-8-13)17(22)21-16(18(23)24)9-12-10-20-15-4-2-1-3-14(12)15/h1-8,10,16,20H,9H2,(H,21,22)(H,23,24)/t16-/m0/s1 |
| Stdinchikey: | QJERBBQXOMUURJ-INIZCTEOSA-N |
Benzotript, also known as N-(p-chlorobenzoyl)-L-tryptophan, is a muscle relaxant that inhibits gastric secretion and was never marketed.[1] [2] It is a tryptamine derivative and the N-(4-chlorobenzoyl) analogue of the amino acid tryptophan. Similarly to proglumide (N2-benzoyl-N,N-dipropyl-α-glutamine), the drug acts as a competitive and non-selective cholecystokinin receptor antagonist.[3] Other more potent tryptophan derivatives have also been developed as cholecystokinin (CCK) antagonists.