| Elimination Half-Life: | 60 h (45.8–93.7 h) |
| Cas Number: | 946128-88-7 |
| Pubchem: | 16719221 |
| Drugbank: | DB15254 |
| Chemspiderid: | 17623621 |
| Unii: | D0D4252V97 |
| Kegg: | D12515 |
| Chebi: | 78825 |
| Chembl: | 3264002 |
| Pdb Ligand: | CHU |
| Synonyms: | RO-5126766; CH-5126766; CKI-27; R-7304; RG-7304 |
| Iupac Name: | 3-3-fluoro-2-(methylsulfamoylamino)pyridin-4-ylmethyl]-4-methyl-7-pyrimidin-2-yloxychromen-2-one| C=21 | H=18 | F=1 | N=5 | O=5 | S=1| SMILES = CC1=C(C(=O)OC2=C1C=CC(=C2)OC3=NC=CC=N3)CC4=C(C(=NC=C4)NS(=O)(=O)NC)F| StdInChI = 1S/C21H18FN5O5S/c1-12-15-5-4-14(31-21-25-7-3-8-26-21)11-17(15)32-20(28)16(12)10-13-6-9-24-19(18(13)22)27-33(29,30)23-2/h3-9,11,23H,10H2,1-2H3,(H,24,27)| StdInChIKey = LMMJFBMMJUMSJS-UHFFFAOYSA-N}} Avutometinib (INN; codenamed RO-5126766, CH-5126766, CKI-27, R-7304, RG-7304, and VS-6766 at various stages of its development) is an inhibitor of Ras-Raf-MEK-ERK signaling being developed as a potential treatment for cancer. It was discovered by Chugai Pharmaceutical Co. (a subsidiary of Roche) through derivatization of a hit compound identified by high-throughput screening.[1] It was licensed by Verastem Oncology in 2020 for clinical trials.[2] [3] References} |