| Atc Prefix: | J05 |
| Atc Suffix: | AP06 |
| Cas Number: | 630420-16-5 |
| Pubchem: | 16076883 |
| Iuphar Ligand: | 10882 |
| Drugbank: | DB11586 |
| Chemspiderid: | 17235944 |
| Unii: | S9X0KRJ00S |
| Kegg: | D10093 |
| Chebi: | 134723 |
| Chembl: | 2105735 |
| Synonyms: | BMS-650032 |
| Iupac Name: | tert-butyl N-[(2S)-1-[(2S,4R)-4-(7-chloro-4-methoxyisoquinolin-1-yl)oxy-2-[[(1R,2S)-1-(cyclopropylsulfonylcarbamoyl)-2-ethenylcyclopropyl]carbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamate| C=35 | H=46 | Cl=1 | N=5 | O=9 | S=1| molecular_weight = | SMILES = CC(C)(C)[C@@H](C(=O)N1C[C@@H](C[C@H]1C(=O)N[C@@]2(C[C@H]2C=C)C(=O)NS(=O)(=O)C3CC3)OC4=NC=C(C5=C4C=C(C=C5)Cl)OC)NC(=O)OC(C)(C)C| Jmol = | StdInChI = InChI=1S/C35H46ClN5O9S/c1-9-19-16-35(19,31(44)40-51(46,47)22-11-12-22)39-28(42)25-15-21(49-29-24-14-20(36)10-13-23(24)26(48-8)17-37-29)18-41(25)30(43)27(33(2,3)4)38-32(45)50-34(5,6)7/h9-10,13-14,17,19,21-22,25,27H,1,11-12,15-16,18H2,2-8H3,(H,38,45)(H,39,42)(H,40,44)/t19-,21-,25+,27-,35-/m1/s1| StdInChI_comment = | StdInChIKey = XRWSZZJLZRKHHD-WVWIJVSJSA-N| density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} Asunaprevir (formerly BMS-650032, brand name in Japan and Russia[1] Sunvepra) is an experimental drug candidate for the treatment of hepatitis C. It was undergoing development by Bristol-Myers Squibb and has completed Phase III clinical trials in 2013.[2] Asunaprevir is an inhibitor of the hepatitis C virus enzyme serine protease NS3.[3] Asunaprevir is being tested in combination with pegylated interferon and ribavirin, as well as in interferon-free regimens with other direct-acting antiviral agents including daclatasvir.[4] [5] [6] References |