| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 457811074 |
| Iupac Name: | 9-methyl-3-oxa-9-azatricyclo[3.2.1.0<sup>2,4</sup>]non-7-yl α-hydroxy-α-(hydroxymethyl)benzeneacetate |
| Cas Number: | 52646-92-1 |
| Unii: | Z75256J75J |
| Atc Prefix: | none |
| Stdinchi: | 1S/C17H21NO5/c1-18-12-7-11(8-13(18)15-14(12)23-15)22-16(20)17(21,9-19)10-5-3-2-4-6-10/h2-6,11-15,19,21H,7-9H2,1H3/t11?,12-,13+,14-,15+,17-/m1/s1 |
| Stdinchikey: | JEJREKXHLFEVHN-QDXGGTILSA-N |
| Pubchem: | 4105431 |
| Chemspiderid: | 9791461 |
| C: | 17 |
| H: | 21 |
| N: | 1 |
| O: | 5 |
| Smiles: | O=C(OC1CC2N(C(C1)C3OC23)C)C(O)(c4ccccc4)CO |
Anisodine, also known as daturamine and α-hydroxyscopolamine, is an antispasmodic and anticholinergic drug used in the treatment of acute circulatory shock in China.[1] [2] It is a tropane alkaloid and is found naturally in plants of the family Solanaceae - notably Anisodus tanguticus (syn. Scopolia tangutica.[3] [2] Anisodine acts as a muscarinic acetylcholine receptor antagonist and α1-adrenergic receptor antagonist.
(-)-Anisodine can be efficiently prepared using 6-beta-acetyltropine as the starting material via a key step of the Sharpless asymmetric dihydroxylation (AD).