| Type: | combo |
| Verifiedrevid: | 451608217 |
| Component1: | Aliskiren |
| Class1: | Renin inhibitor |
| Component2: | Amlodipine |
| Class2: | Calcium channel blocker |
| Component3: | Hydrochlorothiazide |
| Class3: | Diuretic |
| Tradename: | Amturnide |
| Dailymedid: | Amturnide |
| Routes Of Administration: | By mouth |
| Atc Prefix: | C09 |
| Atc Suffix: | XA54 |
| Legal Us: | Rx-only |
| Legal Us Comment: | [1] |
| Pubchem: | 56841821 |
| Kegg: | D10291 |
| C: | 57 |
| H: | 86 |
| Cl: | 2 |
| N: | 8 |
| O: | 15 |
| S: | 2 |
| Smiles: | CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2Cl)C(=O)OC)C)COCCN.CC(C)C(CC1=CC(=C(C=C1)OC)OCCCOC)CC(C(CC(C(C)C)C(=O)NCC(C)(C)C(=O)N)O)N.C1NC2=CC(=C(C=C2S(=O)(=O)N1)S(=O)(=O)N)Cl |
| Stdinchi: | 1S/C30H53N3O6.C20H25ClN2O5.C7H8ClN3O4S2/c1-19(2)22(14-21-10-11-26(38-8)27(15-21)39-13-9-12-37-7)16-24(31)25(34)17-23(20(3)4)28(35)33-18-30(5,6)29(32)36;1-4-28-20(25)18-15(11-27-10-9-22)23-12(2)16(19(24)26-3)17(18)13-7-5-6-8-14(13)21;8-4-1-5-7(2-6(4)16(9,12)13)17(14,15)11-3-10-5/h10-11,15,19-20,22-25,34H,9,12-14,16-18,31H2,1-8H3,(H2,32,36)(H,33,35);5-8,17,23H,4,9-11,22H2,1-3H3;1-2,10-11H,3H2,(H2,9,12,13)/t22-,23+,24-,25-;;/m0../s1 |
| Stdinchikey: | YJDDFLDXUPNQTO-WMEHTASQSA-N |
Aliskiren/amlodipine/hydrochlorothiazide, sold under the brand name Amturnide, is a fixed-dose combination medication that is used to treat high blood pressure.[2] It contains aliskiren, a renin inhibitor; amlodipine, as the besylate, a calcium channel blocker; and hydrochlorothiazide, a thiazide diuretic. It is taken by mouth.
It was approved for medical use in the United States in December 2010.[3] [4] Amturnide was withdrawn by Novartis from the US market in 2017.[5]