Cas Number: | 1097628-00-6 |
Pubchem: | 25215428 |
Chemspiderid: | 24662280 |
Chembl: | 1081658 |
Pdb Ligand: | KRV |
Synonyms: | ACC-007, KM-023, Aibangde, Einovirine |
Iupac Name: | 3-(3-ethyl-2,6-dioxo-5-propan-2-ylpyrimidine-4-carbonyl)-5-methylbenzonitrile| C=18 | H=19 | N=3 | O=3| molecular_weight = | SMILES = CCN1C(=C(C(=O)NC1=O)C(C)C)C(=O)C2=CC(=CC(=C2)C#N)C| Jmol = | StdInChI = InChI=1S/C18H19N3O3/c1-5-21-15(14(10(2)3)17(23)20-18(21)24)16(22)13-7-11(4)6-12(8-13)9-19/h6-8,10H,5H2,1-4H3,(H,20,23,24)| StdInChIKey = AYPIJAMXGVYYRQ-UHFFFAOYSA-N| density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }} Ainuovirine is a non-nucleoside reverse transcriptase inhibitor (NNRTI) being developed by Kainos Medicine for the treatment of HIV infections.[1] Ainuovirine was approved in China in 2021 for the treatment of HIV-1 infection.[2] References |