| Drug Name: | 5,6-MeO-MiPT |
| Cas Number: | 96096-58-1 |
| Unii: | BS78RK38CG |
| Pubchem: | 44382345 |
| Chemspiderid: | 23511916 |
| Chembl: | 172460 |
| Synonyms: | 5,6-dimethoxy-N-methyl-N-isopropyltryptamine |
| Iupac Name: | N-[2-(5,6-dimethoxy-1H-indol-3-yl)ethyl]-N-methylpropan-2-amine |
| C: | 16 |
| H: | 24 |
| N: | 2 |
| O: | 2 |
| Smiles: | CC(C)N(C)CCc2c[nH]c1cc(OC)c(OC)cc12 |
| Stdinchi: | 1S/C16H24N2O2/c1-11(2)18(3)7-6-12-10-17-14-9-16(20-5)15(19-4)8-13(12)14/h8-11,17H,6-7H2,1-5H3 |
| Stdinchikey: | XXWWFLAMFUOAQG-UHFFFAOYSA-N |
5,6-MeO-MiPT, or 5,6-dimethoxy-N-methyl-N-isopropyltryptamine, is a lesser-known psychedelic drug. It is the 5,6-dimethoxy analog of MiPT. 5,6-MeO-MiPT was first synthesized by Alexander Shulgin. In his book TiHKAL (Tryptamines I Have Known and Loved), 5,6-MeO-MiPT produces no noticeable psychoactive effects. Very little data exists about the pharmacological properties, metabolism, and toxicity of 5,6-MeO-MiPT.