| Verifiedfields: | changed |
| Verifiedrevid: | 477216871 |
| Iupac Name: | (5-bromo-4,7-dimethoxy-2,3-dihydro-1H-inden-1-yl)methanamine |
| Legal Status: | Uncontrolled |
| Routes Of Administration: | Oral |
| Cas Number: | 912342-23-5 |
| Atc Prefix: | none |
| Pubchem: | 16086368 |
| Chemspiderid: | 17245022 |
| Unii: | ZMP92SN5X2 |
| Chembl: | 424890 |
| C: | 12 |
| H: | 16 |
| Br: | 1 |
| N: | 1 |
| O: | 2 |
| Smiles: | COc1c(Br)cc(OC)c2c1CCC2CN |
| Stdinchi: | 1S/C12H16BrNO2/c1-15-10-5-9(13)12(16-2)8-4-3-7(6-14)11(8)10/h5,7H,3-4,6,14H2,1-2H3 |
| Stdinchikey: | HCLPGYNQMVSQIM-UHFFFAOYSA-N |
2CB-Ind is a conformationally-restricted derivative of the phenethylamine hallucinogen 2C-B, discovered in 1974 by Alexander Shulgin. It acts as a moderately potent and selective agonist for the 5-HT2A and 5-HT2C receptors, but unlike the corresponding benzocyclobutene derivative TCB-2 which is considerably more potent than the parent compound 2C-B, 2CB-Ind is several times weaker, with racemic 2CB-Ind having a Ki of 47nM at the human 5-HT2A receptor, only slightly more potent than the mescaline analogue (R)-jimscaline.[1] [2]