| Verifiedfields: | changed |
| Watchedfields: | changed |
| Verifiedrevid: | 454826394 |
| Iupac Name: | 1-(1,3-Benzodioxol-5-yl)-N-methylpropan-1-amine |
| Cas Number: | 127292-43-7 |
| Cas Supplemental: | (hydrochloride) |
| Unii: | 5U214IRH62 |
| Atc Prefix: | none |
| Pubchem: | 14647597 |
| Chemspiderid: | 27523957 |
| C: | 11 |
| H: | 15 |
| N: | 1 |
| O: | 2 |
| Smiles: | CNC(CC)C1=CC2=C(C=C1)OCO2 |
| Stdinchi: | 1S/C11H15NO2/c1-3-9(12-2)8-4-5-10-11(6-8)14-7-13-10/h4-6,9,12H,3,7H2,1-2H3 |
| Stdinchikey: | NLINVDHEDVEOMJ-UHFFFAOYSA-N |
1-Methylamino-1-(3,4-methylenedioxyphenyl)propane or M-ALPHA is an empathogen, reported by Alexander Shulgin in his book PIHKAL as a positional isomer of MDMA, and subsequently found being sold as a designer drug in the UK in 2010, and reported to the EMCDDA new drug monitoring service.[1] It was described by Alexander Shulgin as similar in action to its demethylated homologue, ALPHA, but with roughly twice the duration and twice the potency.